C12H20N2O3S2 — CID 42546177
N-[[(3R)-1,1-dioxothiolan-3-yl]carbamothioyl]cyclohexanecarboxamide (PubChem CID 42546177) has the molecular formula C12H20N2O3S2 and a molecular weight of 304.44 g/mol. Its IUPAC name is N-[[(3R)-1,1-dioxothiolan-3-yl]carbamothioyl]cyclohexanecarboxamide.
| Compound Name | N-[[(3R)-1,1-dioxothiolan-3-yl]carbamothioyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 42546177 |
| Molecular Formula | C12H20N2O3S2 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | N-[[(3R)-1,1-dioxothiolan-3-yl]carbamothioyl]cyclohexanecarboxamide |
| SMILES | O=C(NC(=S)N[C@@H]1CCS(=O)(=O)C1)C1CCCCC1 |
| InChI | InChI=1S/C12H20N2O3S2/c15-11(9-4-2-1-3-5-9)14-12(18)13-10-6-7-19(16,17)8-10/h9-10H,1-8H2,(H2,13,14,15,18)/t10-/m1/s1 |
| InChIKey | FFQAHLPBLNHMKN-SNVBAGLBSA-N |
| XLogP | 0.74 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|