C16H24N2O3S2 — CID 7123579
N-[[(3R)-1,1-dioxothiolan-3-yl]carbamothioyl]adamantane-1-carboxamide (PubChem CID 7123579) has the molecular formula C16H24N2O3S2 and a molecular weight of 356.51 g/mol. Its IUPAC name is N-[[(3R)-1,1-dioxothiolan-3-yl]carbamothioyl]adamantane-1-carboxamide.
| Compound Name | N-[[(3R)-1,1-dioxothiolan-3-yl]carbamothioyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 7123579 |
| Molecular Formula | C16H24N2O3S2 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | N-[[(3R)-1,1-dioxothiolan-3-yl]carbamothioyl]adamantane-1-carboxamide |
| SMILES | O=C(NC(=S)N[C@@H]1CCS(=O)(=O)C1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C16H24N2O3S2/c19-14(18-15(22)17-13-1-2-23(20,21)9-13)16-6-10-3-11(7-16)5-12(4-10)8-16/h10-13H,1-9H2,(H2,17,18,19,22)/t10?,11?,12?,13-,16?/m1/s1 |
| InChIKey | VXGRSEZVRLMBEG-RRHJKOLHSA-N |
| XLogP | 1.38 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|