C22H27ClN2O2S2 — CID 43076453
3-[2-(4-chlorophenyl)sulfanylethyl]-1-[(2-methoxyphenyl)methyl]-1-(oxolan-2-ylmethyl)thiourea (PubChem CID 43076453) has the molecular formula C22H27ClN2O2S2 and a molecular weight of 451.06 g/mol. Its IUPAC name is 3-[2-(4-chlorophenyl)sulfanylethyl]-1-[(2-methoxyphenyl)methyl]-1-(oxolan-2-ylmethyl)thiourea.
| Compound Name | 3-[2-(4-chlorophenyl)sulfanylethyl]-1-[(2-methoxyphenyl)methyl]-1-(oxolan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 43076453 |
| Molecular Formula | C22H27ClN2O2S2 |
| Molecular Weight | 451.06 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | 3-[2-(4-chlorophenyl)sulfanylethyl]-1-[(2-methoxyphenyl)methyl]-1-(oxolan-2-ylmethyl)thiourea |
| SMILES | COc1ccccc1CN(CC1CCCO1)C(=S)NCCSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H27ClN2O2S2/c1-26-21-7-3-2-5-17(21)15-25(16-19-6-4-13-27-19)22(28)24-12-14-29-20-10-8-18(23)9-11-20/h2-3,5,7-11,19H,4,6,12-16H2,1H3,(H,24,28) |
| InChIKey | WDSGOPUXXVNILA-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.06 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|