C13H11Cl2N3O2S — CID 43078049
2-[3-(2,3-dichlorophenyl)propanoylamino]-1,3-thiazole-5-carboxamide (PubChem CID 43078049) has the molecular formula C13H11Cl2N3O2S and a molecular weight of 344.22 g/mol. Its IUPAC name is 2-[3-(2,3-dichlorophenyl)propanoylamino]-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[3-(2,3-dichlorophenyl)propanoylamino]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 43078049 |
| Molecular Formula | C13H11Cl2N3O2S |
| Molecular Weight | 344.22 g/mol |
| Exact Mass | 342.99 |
| IUPAC Name | 2-[3-(2,3-dichlorophenyl)propanoylamino]-1,3-thiazole-5-carboxamide |
| SMILES | NC(=O)c1cnc(NC(=O)CCc2cccc(Cl)c2Cl)s1 |
| InChI | InChI=1S/C13H11Cl2N3O2S/c14-8-3-1-2-7(11(8)15)4-5-10(19)18-13-17-6-9(21-13)12(16)20/h1-3,6H,4-5H2,(H2,16,20)(H,17,18,19) |
| InChIKey | HXUCVLVOHXKWOV-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.22 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |