C11H18N2O3S — CID 43091358
2-[2-[(2-cyano-3-methylbutan-2-yl)amino]-2-oxoethyl]sulfanylpropanoic acid (PubChem CID 43091358) has the molecular formula C11H18N2O3S and a molecular weight of 258.34 g/mol. Its IUPAC name is 2-[2-[(2-cyano-3-methylbutan-2-yl)amino]-2-oxoethyl]sulfanylpropanoic acid.
| Compound Name | 2-[2-[(2-cyano-3-methylbutan-2-yl)amino]-2-oxoethyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 43091358 |
| Molecular Formula | C11H18N2O3S |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 2-[2-[(2-cyano-3-methylbutan-2-yl)amino]-2-oxoethyl]sulfanylpropanoic acid |
| SMILES | CC(SCC(=O)NC(C)(C#N)C(C)C)C(=O)O |
| InChI | InChI=1S/C11H18N2O3S/c1-7(2)11(4,6-12)13-9(14)5-17-8(3)10(15)16/h7-8H,5H2,1-4H3,(H,13,14)(H,15,16) |
| InChIKey | FHKUABVAHWNOHO-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |