C13H21N3OS2 — CID 7606007
[2-[[(2S)-2-cyano-3-methylbutan-2-yl]amino]-2-oxoethyl] pyrrolidine-1-carbodithioate (PubChem CID 7606007) has the molecular formula C13H21N3OS2 and a molecular weight of 299.47 g/mol. Its IUPAC name is [2-[[(2S)-2-cyano-3-methylbutan-2-yl]amino]-2-oxoethyl] pyrrolidine-1-carbodithioate.
| Compound Name | [2-[[(2S)-2-cyano-3-methylbutan-2-yl]amino]-2-oxoethyl] pyrrolidine-1-carbodithioate |
|---|---|
| PubChem CID | 7606007 |
| Molecular Formula | C13H21N3OS2 |
| Molecular Weight | 299.47 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | [2-[[(2S)-2-cyano-3-methylbutan-2-yl]amino]-2-oxoethyl] pyrrolidine-1-carbodithioate |
| SMILES | CC(C)[C@@](C)(C#N)NC(=O)CSC(=S)N1CCCC1 |
| InChI | InChI=1S/C13H21N3OS2/c1-10(2)13(3,9-14)15-11(17)8-19-12(18)16-6-4-5-7-16/h10H,4-8H2,1-3H3,(H,15,17)/t13-/m1/s1 |
| InChIKey | KGQYBZMBQFTSSN-CYBMUJFWSA-N |
| XLogP | 2.15 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.47 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|