C14H18N2O4S — CID 43097620
1-piperidin-1-ylsulfonyl-2,3-dihydroindole-2-carboxylic acid (PubChem CID 43097620) has the molecular formula C14H18N2O4S and a molecular weight of 310.37 g/mol. Its IUPAC name is 1-piperidin-1-ylsulfonyl-2,3-dihydroindole-2-carboxylic acid.
| Compound Name | 1-piperidin-1-ylsulfonyl-2,3-dihydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 43097620 |
| Molecular Formula | C14H18N2O4S |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 1-piperidin-1-ylsulfonyl-2,3-dihydroindole-2-carboxylic acid |
| SMILES | O=C(O)C1Cc2ccccc2N1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C14H18N2O4S/c17-14(18)13-10-11-6-2-3-7-12(11)16(13)21(19,20)15-8-4-1-5-9-15/h2-3,6-7,13H,1,4-5,8-10H2,(H,17,18) |
| InChIKey | MMOCDCRQCXPZEJ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |