C17H19F2N — CID 43101828
N-[1-(2,6-difluorophenyl)ethyl]-3-phenylpropan-1-amine (PubChem CID 43101828) has the molecular formula C17H19F2N and a molecular weight of 275.34 g/mol. Its IUPAC name is N-[1-(2,6-difluorophenyl)ethyl]-3-phenylpropan-1-amine.
| Compound Name | N-[1-(2,6-difluorophenyl)ethyl]-3-phenylpropan-1-amine |
|---|---|
| PubChem CID | 43101828 |
| Molecular Formula | C17H19F2N |
| Molecular Weight | 275.34 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | N-[1-(2,6-difluorophenyl)ethyl]-3-phenylpropan-1-amine |
| SMILES | CC(NCCCc1ccccc1)c1c(F)cccc1F |
| InChI | InChI=1S/C17H19F2N/c1-13(17-15(18)10-5-11-16(17)19)20-12-6-9-14-7-3-2-4-8-14/h2-5,7-8,10-11,13,20H,6,9,12H2,1H3 |
| InChIKey | RXUKSKCLFMVXLP-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.34 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|