C18H24ClNS — CID 140973332
3-methyl-2-[1-(3-phenylpropylamino)ethyl]benzenethiol;hydrochloride (PubChem CID 140973332) has the molecular formula C18H24ClNS and a molecular weight of 321.92 g/mol. Its IUPAC name is 3-methyl-2-[1-(3-phenylpropylamino)ethyl]benzenethiol;hydrochloride.
| Compound Name | 3-methyl-2-[1-(3-phenylpropylamino)ethyl]benzenethiol;hydrochloride |
|---|---|
| PubChem CID | 140973332 |
| Molecular Formula | C18H24ClNS |
| Molecular Weight | 321.92 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | 3-methyl-2-[1-(3-phenylpropylamino)ethyl]benzenethiol;hydrochloride |
| SMILES | Cc1cccc(S)c1C(C)NCCCc1ccccc1.Cl |
| InChI | InChI=1S/C18H23NS.ClH/c1-14-8-6-12-17(20)18(14)15(2)19-13-7-11-16-9-4-3-5-10-16;/h3-6,8-10,12,15,19-20H,7,11,13H2,1-2H3;1H |
| InChIKey | TWNZXHOTJIXFMJ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.92 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|