C21H22F3NO — CID 68813678
N-[1-(2-methyl-1-benzofuran-3-yl)ethyl]-3-[3-(trifluoromethyl)phenyl]propan-1-amine (PubChem CID 68813678) has the molecular formula C21H22F3NO and a molecular weight of 361.41 g/mol. Its IUPAC name is N-[1-(2-methyl-1-benzofuran-3-yl)ethyl]-3-[3-(trifluoromethyl)phenyl]propan-1-amine.
| Compound Name | N-[1-(2-methyl-1-benzofuran-3-yl)ethyl]-3-[3-(trifluoromethyl)phenyl]propan-1-amine |
|---|---|
| PubChem CID | 68813678 |
| Molecular Formula | C21H22F3NO |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | N-[1-(2-methyl-1-benzofuran-3-yl)ethyl]-3-[3-(trifluoromethyl)phenyl]propan-1-amine |
| SMILES | Cc1oc2ccccc2c1C(C)NCCCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H22F3NO/c1-14(20-15(2)26-19-11-4-3-10-18(19)20)25-12-6-8-16-7-5-9-17(13-16)21(22,23)24/h3-5,7,9-11,13-14,25H,6,8,12H2,1-2H3 |
| InChIKey | PENCNCUUHIKKRI-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|