C35H27N3O6 — CID 4310288
3-O-benzhydryl 1-O-methyl 1-cyano-2-(4-nitrophenyl)-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline-1,3-dicarboxylate (PubChem CID 4310288) has the molecular formula C35H27N3O6 and a molecular weight of 585.62 g/mol. Its IUPAC name is 3-O-benzhydryl 1-O-methyl 1-cyano-2-(4-nitrophenyl)-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline-1,3-dicarboxylate.
| Compound Name | 3-O-benzhydryl 1-O-methyl 1-cyano-2-(4-nitrophenyl)-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline-1,3-dicarboxylate |
|---|---|
| PubChem CID | 4310288 |
| Molecular Formula | C35H27N3O6 |
| Molecular Weight | 585.62 g/mol |
| Exact Mass | 585.19 |
| IUPAC Name | 3-O-benzhydryl 1-O-methyl 1-cyano-2-(4-nitrophenyl)-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline-1,3-dicarboxylate |
| SMILES | COC(=O)C1(C#N)C(c2ccc([N+](=O)[O-])cc2)C(C(=O)OC(c2ccccc2)c2ccccc2)N2C=Cc3ccccc3C21 |
| InChI | InChI=1S/C35H27N3O6/c1-43-34(40)35(22-36)29(24-16-18-27(19-17-24)38(41)42)30(37-21-20-23-10-8-9-15-28(23)32(35)37)33(39)44-31(25-11-4-2-5-12-25)26-13-6-3-7-14-26/h2-21,29-32H,1H3 |
| InChIKey | IBLOBTNDDZOBNZ-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 122.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.62 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|