C12H21NO6S — CID 43104083
4-(3-ethoxycarbonylpiperidin-1-yl)sulfonylbutanoic acid (PubChem CID 43104083) has the molecular formula C12H21NO6S and a molecular weight of 307.37 g/mol. Its IUPAC name is 4-(3-ethoxycarbonylpiperidin-1-yl)sulfonylbutanoic acid.
| Compound Name | 4-(3-ethoxycarbonylpiperidin-1-yl)sulfonylbutanoic acid |
|---|---|
| PubChem CID | 43104083 |
| Molecular Formula | C12H21NO6S |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 4-(3-ethoxycarbonylpiperidin-1-yl)sulfonylbutanoic acid |
| SMILES | CCOC(=O)C1CCCN(S(=O)(=O)CCCC(=O)O)C1 |
| InChI | InChI=1S/C12H21NO6S/c1-2-19-12(16)10-5-3-7-13(9-10)20(17,18)8-4-6-11(14)15/h10H,2-9H2,1H3,(H,14,15) |
| InChIKey | MXWQREYOLMEXTC-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |