C12H8Cl3N3O2 — CID 43108551
N'-hydroxy-2-(2,4,5-trichlorophenoxy)pyridine-3-carboximidamide (PubChem CID 43108551) has the molecular formula C12H8Cl3N3O2 and a molecular weight of 332.57 g/mol. Its IUPAC name is N'-hydroxy-2-(2,4,5-trichlorophenoxy)pyridine-3-carboximidamide.
| Compound Name | N'-hydroxy-2-(2,4,5-trichlorophenoxy)pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 43108551 |
| Molecular Formula | C12H8Cl3N3O2 |
| Molecular Weight | 332.57 g/mol |
| Exact Mass | 330.97 |
| IUPAC Name | N'-hydroxy-2-(2,4,5-trichlorophenoxy)pyridine-3-carboximidamide |
| SMILES | N/C(=N\O)c1cccnc1Oc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H8Cl3N3O2/c13-7-4-9(15)10(5-8(7)14)20-12-6(11(16)18-19)2-1-3-17-12/h1-5,19H,(H2,16,18) |
| InChIKey | XNSSBXXGWDHPAY-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 80.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.57 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|