About 2-[4-(hydroxymethyl)-2,6-dimethylphenoxy]-N,N-dimethylpropanamide
2-[4-(hydroxymethyl)-2,6-dimethylphenoxy]-N,N-dimethylpropanamide (PubChem CID 43118029) has the molecular formula C14H21NO3
and a molecular weight of 251.33 g/mol. Its IUPAC name is 2-[4-(hydroxymethyl)-2,6-dimethylphenoxy]-N,N-dimethylpropanamide.
Molecular Properties
| Compound Name | 2-[4-(hydroxymethyl)-2,6-dimethylphenoxy]-N,N-dimethylpropanamide |
| PubChem CID | 43118029 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 2-[4-(hydroxymethyl)-2,6-dimethylphenoxy]-N,N-dimethylpropanamide |
| SMILES | Cc1cc(CO)cc(C)c1OC(C)C(=O)N(C)C |
| InChI | InChI=1S/C14H21NO3/c1-9-6-12(8-16)7-10(2)13(9)18-11(3)14(17)15(4)5/h6-7,11,16H,8H2,1-5H3 |
| InChIKey | XVDHDLCICBZBLJ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[4-(hydroxymethyl)-2,6-dimethylphenoxy]-N,N-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(hydroxymethyl)-2,6-dimethylphenoxy]-N,N-dimethylpropanamide?
The IUPAC name of 2-[4-(hydroxymethyl)-2,6-dimethylphenoxy]-N,N-dimethylpropanamide (CID 43118029) is 2-[4-(hydroxymethyl)-2,6-dimethylphenoxy]-N,N-dimethylpropanamide.
What is the SMILES notation for 2-[4-(hydroxymethyl)-2,6-dimethylphenoxy]-N,N-dimethylpropanamide?
The canonical SMILES for 2-[4-(hydroxymethyl)-2,6-dimethylphenoxy]-N,N-dimethylpropanamide is Cc1cc(CO)cc(C)c1OC(C)C(=O)N(C)C.
What is the InChIKey of 2-[4-(hydroxymethyl)-2,6-dimethylphenoxy]-N,N-dimethylpropanamide?
The InChIKey is XVDHDLCICBZBLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO3/c1-9-6-12(8-16)7-10(2)13(9)18-11(3)14(17)15(4)5/h6-7,11,16H,8H2,1-5H3.
What are the key properties of 2-[4-(hydroxymethyl)-2,6-dimethylphenoxy]-N,N-dimethylpropanamide?
2-[4-(hydroxymethyl)-2,6-dimethylphenoxy]-N,N-dimethylpropanamide has a molecular weight of 251.33 g/mol, XLogP of 1.65, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(hydroxymethyl)-2,6-dimethylphenoxy]-N,N-dimethylpropanamide is sourced from PubChem (CID 43118029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).