C17H27NO3 — CID 43127988
1-(2,5-dimethoxyphenyl)-2-(3-methylcyclohexyl)oxyethanamine (PubChem CID 43127988) has the molecular formula C17H27NO3 and a molecular weight of 293.41 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-2-(3-methylcyclohexyl)oxyethanamine.
| Compound Name | 1-(2,5-dimethoxyphenyl)-2-(3-methylcyclohexyl)oxyethanamine |
|---|---|
| PubChem CID | 43127988 |
| Molecular Formula | C17H27NO3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-2-(3-methylcyclohexyl)oxyethanamine |
| SMILES | COc1ccc(OC)c(C(N)COC2CCCC(C)C2)c1 |
| InChI | InChI=1S/C17H27NO3/c1-12-5-4-6-14(9-12)21-11-16(18)15-10-13(19-2)7-8-17(15)20-3/h7-8,10,12,14,16H,4-6,9,11,18H2,1-3H3 |
| InChIKey | LQXJVEVEZOONMD-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |