C29H25N3O2 — CID 4313715
3-(1-benzylindol-3-yl)-1-[2-(1H-indol-3-yl)ethyl]pyrrolidine-2,5-dione (PubChem CID 4313715) has the molecular formula C29H25N3O2 and a molecular weight of 447.54 g/mol. Its IUPAC name is 3-(1-benzylindol-3-yl)-1-[2-(1H-indol-3-yl)ethyl]pyrrolidine-2,5-dione.
| Compound Name | 3-(1-benzylindol-3-yl)-1-[2-(1H-indol-3-yl)ethyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 4313715 |
| Molecular Formula | C29H25N3O2 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | 3-(1-benzylindol-3-yl)-1-[2-(1H-indol-3-yl)ethyl]pyrrolidine-2,5-dione |
| SMILES | O=C1CC(c2cn(Cc3ccccc3)c3ccccc23)C(=O)N1CCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C29H25N3O2/c33-28-16-24(29(34)32(28)15-14-21-17-30-26-12-6-4-10-22(21)26)25-19-31(18-20-8-2-1-3-9-20)27-13-7-5-11-23(25)27/h1-13,17,19,24,30H,14-16,18H2 |
| InChIKey | DOCWRDCHTGLTCR-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 58.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|