C23H24N2O4S — CID 101371437
(3R,4S)-1-[2-(1H-indol-3-yl)ethyl]-4-methyl-3-(4-methylphenyl)sulfonylpiperidine-2,6-dione (PubChem CID 101371437) has the molecular formula C23H24N2O4S and a molecular weight of 424.52 g/mol. Its IUPAC name is (3R,4S)-1-[2-(1H-indol-3-yl)ethyl]-4-methyl-3-(4-methylphenyl)sulfonylpiperidine-2,6-dione.
| Compound Name | (3R,4S)-1-[2-(1H-indol-3-yl)ethyl]-4-methyl-3-(4-methylphenyl)sulfonylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 101371437 |
| Molecular Formula | C23H24N2O4S |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | (3R,4S)-1-[2-(1H-indol-3-yl)ethyl]-4-methyl-3-(4-methylphenyl)sulfonylpiperidine-2,6-dione |
| SMILES | Cc1ccc(S(=O)(=O)[C@H]2C(=O)N(CCc3c[nH]c4ccccc34)C(=O)C[C@@H]2C)cc1 |
| InChI | InChI=1S/C23H24N2O4S/c1-15-7-9-18(10-8-15)30(28,29)22-16(2)13-21(26)25(23(22)27)12-11-17-14-24-20-6-4-3-5-19(17)20/h3-10,14,16,22,24H,11-13H2,1-2H3/t16-,22+/m0/s1 |
| InChIKey | LJQHYQVJZMLYHZ-KSFYIVLOSA-N |
| XLogP | 3.26 |
| TPSA | 87.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|