C23H21N3O4 — CID 71299392
5-amino-3-[2-(1H-indol-3-yl)ethyl]-8-methoxy-1,10b-dihydrochromeno[3,4-c]pyridine-2,4-dione (PubChem CID 71299392) has the molecular formula C23H21N3O4 and a molecular weight of 403.44 g/mol. Its IUPAC name is 5-amino-3-[2-(1H-indol-3-yl)ethyl]-8-methoxy-1,10b-dihydrochromeno[3,4-c]pyridine-2,4-dione.
| Compound Name | 5-amino-3-[2-(1H-indol-3-yl)ethyl]-8-methoxy-1,10b-dihydrochromeno[3,4-c]pyridine-2,4-dione |
|---|---|
| PubChem CID | 71299392 |
| Molecular Formula | C23H21N3O4 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 5-amino-3-[2-(1H-indol-3-yl)ethyl]-8-methoxy-1,10b-dihydrochromeno[3,4-c]pyridine-2,4-dione |
| SMILES | COc1ccc2c(c1)OC(N)=C1C(=O)N(CCc3c[nH]c4ccccc34)C(=O)CC12 |
| InChI | InChI=1S/C23H21N3O4/c1-29-14-6-7-16-17-11-20(27)26(23(28)21(17)22(24)30-19(16)10-14)9-8-13-12-25-18-5-3-2-4-15(13)18/h2-7,10,12,17,25H,8-9,11,24H2,1H3 |
| InChIKey | MZFQICWVPLBEHT-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|