C23H24N2O7 — CID 71299394
5-amino-8-methoxy-3-[(3,4,5-trimethoxyphenyl)methyl]-1,10b-dihydrochromeno[3,4-c]pyridine-2,4-dione (PubChem CID 71299394) has the molecular formula C23H24N2O7 and a molecular weight of 440.45 g/mol. Its IUPAC name is 5-amino-8-methoxy-3-[(3,4,5-trimethoxyphenyl)methyl]-1,10b-dihydrochromeno[3,4-c]pyridine-2,4-dione.
| Compound Name | 5-amino-8-methoxy-3-[(3,4,5-trimethoxyphenyl)methyl]-1,10b-dihydrochromeno[3,4-c]pyridine-2,4-dione |
|---|---|
| PubChem CID | 71299394 |
| Molecular Formula | C23H24N2O7 |
| Molecular Weight | 440.45 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | 5-amino-8-methoxy-3-[(3,4,5-trimethoxyphenyl)methyl]-1,10b-dihydrochromeno[3,4-c]pyridine-2,4-dione |
| SMILES | COc1ccc2c(c1)OC(N)=C1C(=O)N(Cc3cc(OC)c(OC)c(OC)c3)C(=O)CC12 |
| InChI | InChI=1S/C23H24N2O7/c1-28-13-5-6-14-15-10-19(26)25(23(27)20(15)22(24)32-16(14)9-13)11-12-7-17(29-2)21(31-4)18(8-12)30-3/h5-9,15H,10-11,24H2,1-4H3 |
| InChIKey | FBJQBIFPEJMLLH-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 109.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.45 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|