C13H12N2O4 — CID 102166852
5-amino-8-methoxy-1,10b-dihydrochromeno[3,4-c]pyridine-2,4-dione (PubChem CID 102166852) has the molecular formula C13H12N2O4 and a molecular weight of 260.25 g/mol. Its IUPAC name is 5-amino-8-methoxy-1,10b-dihydrochromeno[3,4-c]pyridine-2,4-dione.
| Compound Name | 5-amino-8-methoxy-1,10b-dihydrochromeno[3,4-c]pyridine-2,4-dione |
|---|---|
| PubChem CID | 102166852 |
| Molecular Formula | C13H12N2O4 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 5-amino-8-methoxy-1,10b-dihydrochromeno[3,4-c]pyridine-2,4-dione |
| SMILES | COc1ccc2c(c1)OC(N)=C1C(=O)NC(=O)CC12 |
| InChI | InChI=1S/C13H12N2O4/c1-18-6-2-3-7-8-5-10(16)15-13(17)11(8)12(14)19-9(7)4-6/h2-4,8H,5,14H2,1H3,(H,15,16,17) |
| InChIKey | SVEJCQLOWXTCPT-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|