C16H17ClN2OS — CID 43138039
2-[4-(chloromethyl)-1,3-thiazol-2-yl]-1-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)ethanone (PubChem CID 43138039) has the molecular formula C16H17ClN2OS and a molecular weight of 320.85 g/mol. Its IUPAC name is 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-1-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)ethanone.
| Compound Name | 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-1-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)ethanone |
|---|---|
| PubChem CID | 43138039 |
| Molecular Formula | C16H17ClN2OS |
| Molecular Weight | 320.85 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-1-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)ethanone |
| SMILES | CC1CCc2ccccc2N1C(=O)Cc1nc(CCl)cs1 |
| InChI | InChI=1S/C16H17ClN2OS/c1-11-6-7-12-4-2-3-5-14(12)19(11)16(20)8-15-18-13(9-17)10-21-15/h2-5,10-11H,6-9H2,1H3 |
| InChIKey | SHUKZQGCBMNMDD-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.85 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|