C10H12N4S2 — CID 43140044
3-[methyl(thieno[2,3-d]pyrimidin-4-yl)amino]propanethioamide (PubChem CID 43140044) has the molecular formula C10H12N4S2 and a molecular weight of 252.37 g/mol. Its IUPAC name is 3-[methyl(thieno[2,3-d]pyrimidin-4-yl)amino]propanethioamide.
| Compound Name | 3-[methyl(thieno[2,3-d]pyrimidin-4-yl)amino]propanethioamide |
|---|---|
| PubChem CID | 43140044 |
| Molecular Formula | C10H12N4S2 |
| Molecular Weight | 252.37 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 3-[methyl(thieno[2,3-d]pyrimidin-4-yl)amino]propanethioamide |
| SMILES | CN(CCC(N)=S)c1ncnc2sccc12 |
| InChI | InChI=1S/C10H12N4S2/c1-14(4-2-8(11)15)9-7-3-5-16-10(7)13-6-12-9/h3,5-6H,2,4H2,1H3,(H2,11,15) |
| InChIKey | IDVNTFOGKNERPN-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.37 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|