C16H16ClN3OS — CID 71891705
N-[3-(4-chlorophenoxy)propyl]-N-methylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 71891705) has the molecular formula C16H16ClN3OS and a molecular weight of 333.84 g/mol. Its IUPAC name is N-[3-(4-chlorophenoxy)propyl]-N-methylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[3-(4-chlorophenoxy)propyl]-N-methylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 71891705 |
| Molecular Formula | C16H16ClN3OS |
| Molecular Weight | 333.84 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | N-[3-(4-chlorophenoxy)propyl]-N-methylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | CN(CCCOc1ccc(Cl)cc1)c1ncnc2sccc12 |
| InChI | InChI=1S/C16H16ClN3OS/c1-20(15-14-7-10-22-16(14)19-11-18-15)8-2-9-21-13-5-3-12(17)4-6-13/h3-7,10-11H,2,8-9H2,1H3 |
| InChIKey | VVRXTMWDEDMGDC-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.84 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|