About N-[3-(4-chlorophenoxy)propyl]-N-methylthieno[2,3-d]pyrimidin-4-amine
N-[3-(4-chlorophenoxy)propyl]-N-methylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 71891705) has the molecular formula C16H16ClN3OS
and a molecular weight of 333.84 g/mol. Its IUPAC name is N-[3-(4-chlorophenoxy)propyl]-N-methylthieno[2,3-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | N-[3-(4-chlorophenoxy)propyl]-N-methylthieno[2,3-d]pyrimidin-4-amine |
| PubChem CID | 71891705 |
| Molecular Formula | C16H16ClN3OS |
| Molecular Weight | 333.84 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | N-[3-(4-chlorophenoxy)propyl]-N-methylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | CN(CCCOc1ccc(Cl)cc1)c1ncnc2sccc12 |
| InChI | InChI=1S/C16H16ClN3OS/c1-20(15-14-7-10-22-16(14)19-11-18-15)8-2-9-21-13-5-3-12(17)4-6-13/h3-7,10-11H,2,8-9H2,1H3 |
| InChIKey | VVRXTMWDEDMGDC-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.84 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(4-chlorophenoxy)propyl]-N-methylthieno[2,3-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(4-chlorophenoxy)propyl]-N-methylthieno[2,3-d]pyrimidin-4-amine?
The IUPAC name of N-[3-(4-chlorophenoxy)propyl]-N-methylthieno[2,3-d]pyrimidin-4-amine (CID 71891705) is N-[3-(4-chlorophenoxy)propyl]-N-methylthieno[2,3-d]pyrimidin-4-amine.
What is the SMILES notation for N-[3-(4-chlorophenoxy)propyl]-N-methylthieno[2,3-d]pyrimidin-4-amine?
The canonical SMILES for N-[3-(4-chlorophenoxy)propyl]-N-methylthieno[2,3-d]pyrimidin-4-amine is CN(CCCOc1ccc(Cl)cc1)c1ncnc2sccc12.
What is the InChIKey of N-[3-(4-chlorophenoxy)propyl]-N-methylthieno[2,3-d]pyrimidin-4-amine?
The InChIKey is VVRXTMWDEDMGDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16ClN3OS/c1-20(15-14-7-10-22-16(14)19-11-18-15)8-2-9-21-13-5-3-12(17)4-6-13/h3-7,10-11H,2,8-9H2,1H3.
What are the key properties of N-[3-(4-chlorophenoxy)propyl]-N-methylthieno[2,3-d]pyrimidin-4-amine?
N-[3-(4-chlorophenoxy)propyl]-N-methylthieno[2,3-d]pyrimidin-4-amine has a molecular weight of 333.84 g/mol, XLogP of 4.25, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(4-chlorophenoxy)propyl]-N-methylthieno[2,3-d]pyrimidin-4-amine is sourced from PubChem (CID 71891705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).