About 2-(4,6-dimethyl-2-oxo-1-pentan-3-ylpyrimidin-5-yl)acetic acid
2-(4,6-dimethyl-2-oxo-1-pentan-3-ylpyrimidin-5-yl)acetic acid (PubChem CID 43145204) has the molecular formula C13H20N2O3
and a molecular weight of 252.31 g/mol. Its IUPAC name is 2-(4,6-dimethyl-2-oxo-1-pentan-3-ylpyrimidin-5-yl)acetic acid.
Analyze 2-(4,6-dimethyl-2-oxo-1-pentan-3-ylpyrimidin-5-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,6-dimethyl-2-oxo-1-pentan-3-ylpyrimidin-5-yl)acetic acid?
The IUPAC name of 2-(4,6-dimethyl-2-oxo-1-pentan-3-ylpyrimidin-5-yl)acetic acid (CID 43145204) is 2-(4,6-dimethyl-2-oxo-1-pentan-3-ylpyrimidin-5-yl)acetic acid.
What is the SMILES notation for 2-(4,6-dimethyl-2-oxo-1-pentan-3-ylpyrimidin-5-yl)acetic acid?
The canonical SMILES for 2-(4,6-dimethyl-2-oxo-1-pentan-3-ylpyrimidin-5-yl)acetic acid is CCC(CC)n1c(C)c(CC(=O)O)c(C)nc1=O.
What is the InChIKey of 2-(4,6-dimethyl-2-oxo-1-pentan-3-ylpyrimidin-5-yl)acetic acid?
The InChIKey is HWHGOIUTCHDZKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O3/c1-5-10(6-2)15-9(4)11(7-12(16)17)8(3)14-13(15)18/h10H,5-7H2,1-4H3,(H,16,17).
What are the key properties of 2-(4,6-dimethyl-2-oxo-1-pentan-3-ylpyrimidin-5-yl)acetic acid?
2-(4,6-dimethyl-2-oxo-1-pentan-3-ylpyrimidin-5-yl)acetic acid has a molecular weight of 252.31 g/mol, XLogP of 1.85, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,6-dimethyl-2-oxo-1-pentan-3-ylpyrimidin-5-yl)acetic acid is sourced from PubChem (CID 43145204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).