C9H15ClN2O2 — CID 43146182
N-(2-chloroacetyl)-3-methylpiperidine-1-carboxamide (PubChem CID 43146182) has the molecular formula C9H15ClN2O2 and a molecular weight of 218.68 g/mol. Its IUPAC name is N-(2-chloroacetyl)-3-methylpiperidine-1-carboxamide.
| Compound Name | N-(2-chloroacetyl)-3-methylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 43146182 |
| Molecular Formula | C9H15ClN2O2 |
| Molecular Weight | 218.68 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | N-(2-chloroacetyl)-3-methylpiperidine-1-carboxamide |
| SMILES | CC1CCCN(C(=O)NC(=O)CCl)C1 |
| InChI | InChI=1S/C9H15ClN2O2/c1-7-3-2-4-12(6-7)9(14)11-8(13)5-10/h7H,2-6H2,1H3,(H,11,13,14) |
| InChIKey | UGTKTNZDBSXAFD-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.68 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|