C9H14ClN3O3 — CID 43146143
1-N-(2-chloroacetyl)piperidine-1,3-dicarboxamide (PubChem CID 43146143) has the molecular formula C9H14ClN3O3 and a molecular weight of 247.68 g/mol. Its IUPAC name is 1-N-(2-chloroacetyl)piperidine-1,3-dicarboxamide.
| Compound Name | 1-N-(2-chloroacetyl)piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 43146143 |
| Molecular Formula | C9H14ClN3O3 |
| Molecular Weight | 247.68 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | 1-N-(2-chloroacetyl)piperidine-1,3-dicarboxamide |
| SMILES | NC(=O)C1CCCN(C(=O)NC(=O)CCl)C1 |
| InChI | InChI=1S/C9H14ClN3O3/c10-4-7(14)12-9(16)13-3-1-2-6(5-13)8(11)15/h6H,1-5H2,(H2,11,15)(H,12,14,16) |
| InChIKey | URPHBEYVDDMELC-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.68 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|