C16H35N3O — CID 43147230
4-methoxy-4-methyl-N-[2-methyl-2-(4-methylpiperazin-1-yl)propyl]pentan-2-amine (PubChem CID 43147230) has the molecular formula C16H35N3O and a molecular weight of 285.48 g/mol. Its IUPAC name is 4-methoxy-4-methyl-N-[2-methyl-2-(4-methylpiperazin-1-yl)propyl]pentan-2-amine.
| Compound Name | 4-methoxy-4-methyl-N-[2-methyl-2-(4-methylpiperazin-1-yl)propyl]pentan-2-amine |
|---|---|
| PubChem CID | 43147230 |
| Molecular Formula | C16H35N3O |
| Molecular Weight | 285.48 g/mol |
| Exact Mass | 285.28 |
| IUPAC Name | 4-methoxy-4-methyl-N-[2-methyl-2-(4-methylpiperazin-1-yl)propyl]pentan-2-amine |
| SMILES | COC(C)(C)CC(C)NCC(C)(C)N1CCN(C)CC1 |
| InChI | InChI=1S/C16H35N3O/c1-14(12-16(4,5)20-7)17-13-15(2,3)19-10-8-18(6)9-11-19/h14,17H,8-13H2,1-7H3 |
| InChIKey | BKEYJAGFCJWQAM-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.48 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |