C11H16OS — CID 43161414
1-(2,5-dimethylthiophen-3-yl)-2-methylbutan-1-one (PubChem CID 43161414) has the molecular formula C11H16OS and a molecular weight of 196.31 g/mol. Its IUPAC name is 1-(2,5-dimethylthiophen-3-yl)-2-methylbutan-1-one.
| Compound Name | 1-(2,5-dimethylthiophen-3-yl)-2-methylbutan-1-one |
|---|---|
| PubChem CID | 43161414 |
| Molecular Formula | C11H16OS |
| Molecular Weight | 196.31 g/mol |
| Exact Mass | 196.09 |
| IUPAC Name | 1-(2,5-dimethylthiophen-3-yl)-2-methylbutan-1-one |
| SMILES | CCC(C)C(=O)c1cc(C)sc1C |
| InChI | InChI=1S/C11H16OS/c1-5-7(2)11(12)10-6-8(3)13-9(10)4/h6-7H,5H2,1-4H3 |
| InChIKey | ZRLAWVHAPMHIIX-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.31 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |