C9H11BrOS — CID 43144150
2-bromo-1-(2,5-dimethylthiophen-3-yl)propan-1-one (PubChem CID 43144150) has the molecular formula C9H11BrOS and a molecular weight of 247.16 g/mol. Its IUPAC name is 2-bromo-1-(2,5-dimethylthiophen-3-yl)propan-1-one.
| Compound Name | 2-bromo-1-(2,5-dimethylthiophen-3-yl)propan-1-one |
|---|---|
| PubChem CID | 43144150 |
| Molecular Formula | C9H11BrOS |
| Molecular Weight | 247.16 g/mol |
| Exact Mass | 245.97 |
| IUPAC Name | 2-bromo-1-(2,5-dimethylthiophen-3-yl)propan-1-one |
| SMILES | Cc1cc(C(=O)C(C)Br)c(C)s1 |
| InChI | InChI=1S/C9H11BrOS/c1-5-4-8(7(3)12-5)9(11)6(2)10/h4,6H,1-3H3 |
| InChIKey | ZOIPKDQYHIMYDL-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.16 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|