C11H9F3N2O3S — CID 43164351
8-(2,2,2-trifluoroethoxy)quinoline-5-sulfonamide (PubChem CID 43164351) has the molecular formula C11H9F3N2O3S and a molecular weight of 306.27 g/mol. Its IUPAC name is 8-(2,2,2-trifluoroethoxy)quinoline-5-sulfonamide.
| Compound Name | 8-(2,2,2-trifluoroethoxy)quinoline-5-sulfonamide |
|---|---|
| PubChem CID | 43164351 |
| Molecular Formula | C11H9F3N2O3S |
| Molecular Weight | 306.27 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | 8-(2,2,2-trifluoroethoxy)quinoline-5-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc(OCC(F)(F)F)c2ncccc12 |
| InChI | InChI=1S/C11H9F3N2O3S/c12-11(13,14)6-19-8-3-4-9(20(15,17)18)7-2-1-5-16-10(7)8/h1-5H,6H2,(H2,15,17,18) |
| InChIKey | FLPRVEPZMRAMJZ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.27 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |