C17H19ClN4O5S — CID 4317028
N-[4-[3-(2-chloro-6-nitroanilino)propylsulfamoyl]phenyl]acetamide (PubChem CID 4317028) has the molecular formula C17H19ClN4O5S and a molecular weight of 426.88 g/mol. Its IUPAC name is N-[4-[3-(2-chloro-6-nitroanilino)propylsulfamoyl]phenyl]acetamide.
| Compound Name | N-[4-[3-(2-chloro-6-nitroanilino)propylsulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 4317028 |
| Molecular Formula | C17H19ClN4O5S |
| Molecular Weight | 426.88 g/mol |
| Exact Mass | 426.08 |
| IUPAC Name | N-[4-[3-(2-chloro-6-nitroanilino)propylsulfamoyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)NCCCNc2c(Cl)cccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H19ClN4O5S/c1-12(23)21-13-6-8-14(9-7-13)28(26,27)20-11-3-10-19-17-15(18)4-2-5-16(17)22(24)25/h2,4-9,19-20H,3,10-11H2,1H3,(H,21,23) |
| InChIKey | ZODISLNLLPTPSS-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.88 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|