C11H9N3O4S — CID 43171259
3-methyl-5-[(6-oxo-1H-pyridazine-3-carbonyl)amino]thiophene-2-carboxylic acid (PubChem CID 43171259) has the molecular formula C11H9N3O4S and a molecular weight of 279.28 g/mol. Its IUPAC name is 3-methyl-5-[(6-oxo-1H-pyridazine-3-carbonyl)amino]thiophene-2-carboxylic acid.
| Compound Name | 3-methyl-5-[(6-oxo-1H-pyridazine-3-carbonyl)amino]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 43171259 |
| Molecular Formula | C11H9N3O4S |
| Molecular Weight | 279.28 g/mol |
| Exact Mass | 279.03 |
| IUPAC Name | 3-methyl-5-[(6-oxo-1H-pyridazine-3-carbonyl)amino]thiophene-2-carboxylic acid |
| SMILES | Cc1cc(NC(=O)c2ccc(=O)[nH]n2)sc1C(=O)O |
| InChI | InChI=1S/C11H9N3O4S/c1-5-4-8(19-9(5)11(17)18)12-10(16)6-2-3-7(15)14-13-6/h2-4H,1H3,(H,12,16)(H,14,15)(H,17,18) |
| InChIKey | YKQXNWTXKADTMQ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.28 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |