C10H14N6O4S — CID 43171435
4-amino-2-[[2-(1-cyclopropyltetrazol-5-yl)sulfanylacetyl]amino]-4-oxobutanoic acid (PubChem CID 43171435) has the molecular formula C10H14N6O4S and a molecular weight of 314.33 g/mol. Its IUPAC name is 4-amino-2-[[2-(1-cyclopropyltetrazol-5-yl)sulfanylacetyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-amino-2-[[2-(1-cyclopropyltetrazol-5-yl)sulfanylacetyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 43171435 |
| Molecular Formula | C10H14N6O4S |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 4-amino-2-[[2-(1-cyclopropyltetrazol-5-yl)sulfanylacetyl]amino]-4-oxobutanoic acid |
| SMILES | NC(=O)CC(NC(=O)CSc1nnnn1C1CC1)C(=O)O |
| InChI | InChI=1S/C10H14N6O4S/c11-7(17)3-6(9(19)20)12-8(18)4-21-10-13-14-15-16(10)5-1-2-5/h5-6H,1-4H2,(H2,11,17)(H,12,18)(H,19,20) |
| InChIKey | ZTSMVFVGRJXSAC-UHFFFAOYSA-N |
| XLogP | -1.46 |
| TPSA | 153.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |