C16H16N2O2S — CID 43174852
(2-amino-4H-indeno[2,1-b]thiophen-1-yl)-morpholin-4-ylmethanone (PubChem CID 43174852) has the molecular formula C16H16N2O2S and a molecular weight of 300.38 g/mol. Its IUPAC name is (2-amino-4H-indeno[2,1-b]thiophen-1-yl)-morpholin-4-ylmethanone.
| Compound Name | (2-amino-4H-indeno[2,1-b]thiophen-1-yl)-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 43174852 |
| Molecular Formula | C16H16N2O2S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | (2-amino-4H-indeno[2,1-b]thiophen-1-yl)-morpholin-4-ylmethanone |
| SMILES | Nc1sc2c(c1C(=O)N1CCOCC1)-c1ccccc1C2 |
| InChI | InChI=1S/C16H16N2O2S/c17-15-14(16(19)18-5-7-20-8-6-18)13-11-4-2-1-3-10(11)9-12(13)21-15/h1-4H,5-9,17H2 |
| InChIKey | KKYKGVXAFAEYHZ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|