C13H19N3O — CID 43174942
4-(1-aminopentan-3-yl)-1,3-dihydroquinoxalin-2-one (PubChem CID 43174942) has the molecular formula C13H19N3O and a molecular weight of 233.31 g/mol. Its IUPAC name is 4-(1-aminopentan-3-yl)-1,3-dihydroquinoxalin-2-one.
| Compound Name | 4-(1-aminopentan-3-yl)-1,3-dihydroquinoxalin-2-one |
|---|---|
| PubChem CID | 43174942 |
| Molecular Formula | C13H19N3O |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | 4-(1-aminopentan-3-yl)-1,3-dihydroquinoxalin-2-one |
| SMILES | CCC(CCN)N1CC(=O)Nc2ccccc21 |
| InChI | InChI=1S/C13H19N3O/c1-2-10(7-8-14)16-9-13(17)15-11-5-3-4-6-12(11)16/h3-6,10H,2,7-9,14H2,1H3,(H,15,17) |
| InChIKey | HLSYBZZMUNWNJG-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |