C15H23NO — CID 43183021
3-(cyclopropylmethoxy)-N-(1-phenylethyl)propan-1-amine (PubChem CID 43183021) has the molecular formula C15H23NO and a molecular weight of 233.36 g/mol. Its IUPAC name is 3-(cyclopropylmethoxy)-N-(1-phenylethyl)propan-1-amine.
| Compound Name | 3-(cyclopropylmethoxy)-N-(1-phenylethyl)propan-1-amine |
|---|---|
| PubChem CID | 43183021 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | 3-(cyclopropylmethoxy)-N-(1-phenylethyl)propan-1-amine |
| SMILES | CC(NCCCOCC1CC1)c1ccccc1 |
| InChI | InChI=1S/C15H23NO/c1-13(15-6-3-2-4-7-15)16-10-5-11-17-12-14-8-9-14/h2-4,6-7,13-14,16H,5,8-12H2,1H3 |
| InChIKey | IGVFCCJBBBIJLS-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|