C14H14BrNO3 — CID 43186425
2-[(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)-hydroxymethyl]prop-2-enenitrile (PubChem CID 43186425) has the molecular formula C14H14BrNO3 and a molecular weight of 324.17 g/mol. Its IUPAC name is 2-[(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)-hydroxymethyl]prop-2-enenitrile.
| Compound Name | 2-[(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)-hydroxymethyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 43186425 |
| Molecular Formula | C14H14BrNO3 |
| Molecular Weight | 324.17 g/mol |
| Exact Mass | 323.02 |
| IUPAC Name | 2-[(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)-hydroxymethyl]prop-2-enenitrile |
| SMILES | C=CCOc1c(Br)cc(C(O)C(=C)C#N)cc1OC |
| InChI | InChI=1S/C14H14BrNO3/c1-4-5-19-14-11(15)6-10(7-12(14)18-3)13(17)9(2)8-16/h4,6-7,13,17H,1-2,5H2,3H3 |
| InChIKey | LKKROFXQDDZYAR-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 62.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.17 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|