C10H12Cl2N2O — CID 43214388
2-[(2,6-dichlorophenyl)methylamino]-N-methylacetamide (PubChem CID 43214388) has the molecular formula C10H12Cl2N2O and a molecular weight of 247.12 g/mol. Its IUPAC name is 2-[(2,6-dichlorophenyl)methylamino]-N-methylacetamide.
| Compound Name | 2-[(2,6-dichlorophenyl)methylamino]-N-methylacetamide |
|---|---|
| PubChem CID | 43214388 |
| Molecular Formula | C10H12Cl2N2O |
| Molecular Weight | 247.12 g/mol |
| Exact Mass | 246.03 |
| IUPAC Name | 2-[(2,6-dichlorophenyl)methylamino]-N-methylacetamide |
| SMILES | CNC(=O)CNCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C10H12Cl2N2O/c1-13-10(15)6-14-5-7-8(11)3-2-4-9(7)12/h2-4,14H,5-6H2,1H3,(H,13,15) |
| InChIKey | KQVNEKDDALMRCW-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.12 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |