C14H14N2O5 — CID 43233815
3-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)methoxy]benzoic acid (PubChem CID 43233815) has the molecular formula C14H14N2O5 and a molecular weight of 290.28 g/mol. Its IUPAC name is 3-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)methoxy]benzoic acid.
| Compound Name | 3-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)methoxy]benzoic acid |
|---|---|
| PubChem CID | 43233815 |
| Molecular Formula | C14H14N2O5 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 3-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)methoxy]benzoic acid |
| SMILES | Cn1c(COc2cccc(C(=O)O)c2)cc(=O)n(C)c1=O |
| InChI | InChI=1S/C14H14N2O5/c1-15-10(7-12(17)16(2)14(15)20)8-21-11-5-3-4-9(6-11)13(18)19/h3-7H,8H2,1-2H3,(H,18,19) |
| InChIKey | YBFRWRBJOLXWJH-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 90.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |