3-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)methoxy]benzoic acid

C14H14N2O5 — CID 43233815

IUPAC3-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)methoxy]benzoic acid
SMILESCn1c(COc2cccc(C(=O)O)c2)cc(=O)n(C)c1=O
InChIInChI=1S/C14H14N2O5/c1-15-10(7-12(17)16(2)14(15)20)8-21-11-5-3-4-9(6-11)13(18)19/h3-7H,8H2,1-2H3,(H,18,19)
InChIKeyYBFRWRBJOLXWJH-UHFFFAOYSA-N
MW290.28 g/mol
LogP0.36
Rot. Bonds4

About 3-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)methoxy]benzoic acid

3-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)methoxy]benzoic acid (PubChem CID 43233815) has the molecular formula C14H14N2O5 and a molecular weight of 290.28 g/mol. Its IUPAC name is 3-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)methoxy]benzoic acid.

Molecular Properties

Compound Name3-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)methoxy]benzoic acid
PubChem CID43233815
Molecular FormulaC14H14N2O5
Molecular Weight290.28 g/mol
Exact Mass290.09
IUPAC Name3-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)methoxy]benzoic acid
SMILESCn1c(COc2cccc(C(=O)O)c2)cc(=O)n(C)c1=O
InChIInChI=1S/C14H14N2O5/c1-15-10(7-12(17)16(2)14(15)20)8-21-11-5-3-4-9(6-11)13(18)19/h3-7H,8H2,1-2H3,(H,18,19)
InChIKeyYBFRWRBJOLXWJH-UHFFFAOYSA-N
XLogP0.36
TPSA90.53 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds4
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500290.28
LogP ≤ 50.36
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Analyze 3-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)methoxy]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)methoxy]benzoic acid?
The IUPAC name of 3-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)methoxy]benzoic acid (CID 43233815) is 3-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)methoxy]benzoic acid.
What is the SMILES notation for 3-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)methoxy]benzoic acid?
The canonical SMILES for 3-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)methoxy]benzoic acid is Cn1c(COc2cccc(C(=O)O)c2)cc(=O)n(C)c1=O.
What is the InChIKey of 3-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)methoxy]benzoic acid?
The InChIKey is YBFRWRBJOLXWJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2O5/c1-15-10(7-12(17)16(2)14(15)20)8-21-11-5-3-4-9(6-11)13(18)19/h3-7H,8H2,1-2H3,(H,18,19).
What are the key properties of 3-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)methoxy]benzoic acid?
3-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)methoxy]benzoic acid has a molecular weight of 290.28 g/mol, XLogP of 0.36, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)methoxy]benzoic acid is sourced from PubChem (CID 43233815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).