2-[2-(3,5-difluoroanilino)-2-oxoethyl]sulfanylpropanoic acid

C11H11F2NO3S — CID 43241622

IUPAC2-[2-(3,5-difluoroanilino)-2-oxoethyl]sulfanylpropanoic acid
SMILESCC(SCC(=O)Nc1cc(F)cc(F)c1)C(=O)O
InChIInChI=1S/C11H11F2NO3S/c1-6(11(16)17)18-5-10(15)14-9-3-7(12)2-8(13)4-9/h2-4,6H,5H2,1H3,(H,14,15)(H,16,17)
InChIKeyBGRVJTCRTUFLBJ-UHFFFAOYSA-N
MW275.28 g/mol
LogP2.11
Rot. Bonds5

About 2-[2-(3,5-difluoroanilino)-2-oxoethyl]sulfanylpropanoic acid

2-[2-(3,5-difluoroanilino)-2-oxoethyl]sulfanylpropanoic acid (PubChem CID 43241622) has the molecular formula C11H11F2NO3S and a molecular weight of 275.28 g/mol. Its IUPAC name is 2-[2-(3,5-difluoroanilino)-2-oxoethyl]sulfanylpropanoic acid.

Molecular Properties

Compound Name2-[2-(3,5-difluoroanilino)-2-oxoethyl]sulfanylpropanoic acid
PubChem CID43241622
Molecular FormulaC11H11F2NO3S
Molecular Weight275.28 g/mol
Exact Mass275.04
IUPAC Name2-[2-(3,5-difluoroanilino)-2-oxoethyl]sulfanylpropanoic acid
SMILESCC(SCC(=O)Nc1cc(F)cc(F)c1)C(=O)O
InChIInChI=1S/C11H11F2NO3S/c1-6(11(16)17)18-5-10(15)14-9-3-7(12)2-8(13)4-9/h2-4,6H,5H2,1H3,(H,14,15)(H,16,17)
InChIKeyBGRVJTCRTUFLBJ-UHFFFAOYSA-N
XLogP2.11
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500275.28
LogP ≤ 52.11
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-[2-(3,5-difluoroanilino)-2-oxoethyl]sulfanylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(3,5-difluoroanilino)-2-oxoethyl]sulfanylpropanoic acid?
The IUPAC name of 2-[2-(3,5-difluoroanilino)-2-oxoethyl]sulfanylpropanoic acid (CID 43241622) is 2-[2-(3,5-difluoroanilino)-2-oxoethyl]sulfanylpropanoic acid.
What is the SMILES notation for 2-[2-(3,5-difluoroanilino)-2-oxoethyl]sulfanylpropanoic acid?
The canonical SMILES for 2-[2-(3,5-difluoroanilino)-2-oxoethyl]sulfanylpropanoic acid is CC(SCC(=O)Nc1cc(F)cc(F)c1)C(=O)O.
What is the InChIKey of 2-[2-(3,5-difluoroanilino)-2-oxoethyl]sulfanylpropanoic acid?
The InChIKey is BGRVJTCRTUFLBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11F2NO3S/c1-6(11(16)17)18-5-10(15)14-9-3-7(12)2-8(13)4-9/h2-4,6H,5H2,1H3,(H,14,15)(H,16,17).
What are the key properties of 2-[2-(3,5-difluoroanilino)-2-oxoethyl]sulfanylpropanoic acid?
2-[2-(3,5-difluoroanilino)-2-oxoethyl]sulfanylpropanoic acid has a molecular weight of 275.28 g/mol, XLogP of 2.11, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(3,5-difluoroanilino)-2-oxoethyl]sulfanylpropanoic acid is sourced from PubChem (CID 43241622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).