C11H13N3OS — CID 43249503
2-[(5-phenyl-1,2,4-oxadiazol-3-yl)methylsulfanyl]ethanamine (PubChem CID 43249503) has the molecular formula C11H13N3OS and a molecular weight of 235.31 g/mol. Its IUPAC name is 2-[(5-phenyl-1,2,4-oxadiazol-3-yl)methylsulfanyl]ethanamine.
| Compound Name | 2-[(5-phenyl-1,2,4-oxadiazol-3-yl)methylsulfanyl]ethanamine |
|---|---|
| PubChem CID | 43249503 |
| Molecular Formula | C11H13N3OS |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 2-[(5-phenyl-1,2,4-oxadiazol-3-yl)methylsulfanyl]ethanamine |
| SMILES | NCCSCc1noc(-c2ccccc2)n1 |
| InChI | InChI=1S/C11H13N3OS/c12-6-7-16-8-10-13-11(15-14-10)9-4-2-1-3-5-9/h1-5H,6-8,12H2 |
| InChIKey | XRWYFZLFGWBPHN-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|