C10H21F2N3O2S — CID 43252285
4-[4-(difluoromethylsulfonyl)-1,4-diazepan-1-yl]butan-1-amine (PubChem CID 43252285) has the molecular formula C10H21F2N3O2S and a molecular weight of 285.36 g/mol. Its IUPAC name is 4-[4-(difluoromethylsulfonyl)-1,4-diazepan-1-yl]butan-1-amine.
| Compound Name | 4-[4-(difluoromethylsulfonyl)-1,4-diazepan-1-yl]butan-1-amine |
|---|---|
| PubChem CID | 43252285 |
| Molecular Formula | C10H21F2N3O2S |
| Molecular Weight | 285.36 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 4-[4-(difluoromethylsulfonyl)-1,4-diazepan-1-yl]butan-1-amine |
| SMILES | NCCCCN1CCCN(S(=O)(=O)C(F)F)CC1 |
| InChI | InChI=1S/C10H21F2N3O2S/c11-10(12)18(16,17)15-7-3-6-14(8-9-15)5-2-1-4-13/h10H,1-9,13H2 |
| InChIKey | PJHLWSQITLXMSY-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.36 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|