C6H11F3N2O2S — CID 43361738
1-(trifluoromethylsulfonyl)-1,4-diazepane (PubChem CID 43361738) has the molecular formula C6H11F3N2O2S and a molecular weight of 232.23 g/mol. Its IUPAC name is 1-(trifluoromethylsulfonyl)-1,4-diazepane.
| Compound Name | 1-(trifluoromethylsulfonyl)-1,4-diazepane |
|---|---|
| PubChem CID | 43361738 |
| Molecular Formula | C6H11F3N2O2S |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | 1-(trifluoromethylsulfonyl)-1,4-diazepane |
| SMILES | O=S(=O)(N1CCCNCC1)C(F)(F)F |
| InChI | InChI=1S/C6H11F3N2O2S/c7-6(8,9)14(12,13)11-4-1-2-10-3-5-11/h10H,1-5H2 |
| InChIKey | WPYCLDDQSQWHRR-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |