C13H28F3N5O2S — CID 175452363
1-(trifluoromethylsulfonyl)-1,4,7,11,14-pentazacycloheptadecane (PubChem CID 175452363) has the molecular formula C13H28F3N5O2S and a molecular weight of 375.46 g/mol. Its IUPAC name is 1-(trifluoromethylsulfonyl)-1,4,7,11,14-pentazacycloheptadecane.
| Compound Name | 1-(trifluoromethylsulfonyl)-1,4,7,11,14-pentazacycloheptadecane |
|---|---|
| PubChem CID | 175452363 |
| Molecular Formula | C13H28F3N5O2S |
| Molecular Weight | 375.46 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | 1-(trifluoromethylsulfonyl)-1,4,7,11,14-pentazacycloheptadecane |
| SMILES | O=S(=O)(N1CCCNCCNCCCNCCNCC1)C(F)(F)F |
| InChI | InChI=1S/C13H28F3N5O2S/c14-13(15,16)24(22,23)21-11-2-5-19-7-6-17-3-1-4-18-8-9-20-10-12-21/h17-20H,1-12H2 |
| InChIKey | ZTADCJVPPITQPY-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 85.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.46 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |