C8H17F2N3O2S — CID 43252244
2-[4-(difluoromethylsulfonyl)-1,4-diazepan-1-yl]ethanamine (PubChem CID 43252244) has the molecular formula C8H17F2N3O2S and a molecular weight of 257.31 g/mol. Its IUPAC name is 2-[4-(difluoromethylsulfonyl)-1,4-diazepan-1-yl]ethanamine.
| Compound Name | 2-[4-(difluoromethylsulfonyl)-1,4-diazepan-1-yl]ethanamine |
|---|---|
| PubChem CID | 43252244 |
| Molecular Formula | C8H17F2N3O2S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 2-[4-(difluoromethylsulfonyl)-1,4-diazepan-1-yl]ethanamine |
| SMILES | NCCN1CCCN(S(=O)(=O)C(F)F)CC1 |
| InChI | InChI=1S/C8H17F2N3O2S/c9-8(10)16(14,15)13-4-1-3-12(5-2-11)6-7-13/h8H,1-7,11H2 |
| InChIKey | NMQAUKFIPCTBJF-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |