C9H18F3N3O2S — CID 55010576
N-ethyl-N-(2,2,2-trifluoroethyl)-1,4-diazepane-1-sulfonamide (PubChem CID 55010576) has the molecular formula C9H18F3N3O2S and a molecular weight of 289.32 g/mol. Its IUPAC name is N-ethyl-N-(2,2,2-trifluoroethyl)-1,4-diazepane-1-sulfonamide.
| Compound Name | N-ethyl-N-(2,2,2-trifluoroethyl)-1,4-diazepane-1-sulfonamide |
|---|---|
| PubChem CID | 55010576 |
| Molecular Formula | C9H18F3N3O2S |
| Molecular Weight | 289.32 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | N-ethyl-N-(2,2,2-trifluoroethyl)-1,4-diazepane-1-sulfonamide |
| SMILES | CCN(CC(F)(F)F)S(=O)(=O)N1CCCNCC1 |
| InChI | InChI=1S/C9H18F3N3O2S/c1-2-14(8-9(10,11)12)18(16,17)15-6-3-4-13-5-7-15/h13H,2-8H2,1H3 |
| InChIKey | GRVNRNHDTCBOHF-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.32 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |