About Desglymidodrine
Desglymidodrine (PubChem CID 43260) has the molecular formula C10H15NO3
and a molecular weight of 197.23 g/mol. Its IUPAC name is 2-amino-1-(2,5-dimethoxyphenyl)ethanol.
Molecular Properties
| Compound Name | Desglymidodrine |
| PubChem CID | 43260 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | 2-amino-1-(2,5-dimethoxyphenyl)ethanol |
| SMILES | COC1=CC(=C(C=C1)OC)C(CN)O |
| InChI | InChI=1S/C10H15NO3/c1-13-7-3-4-10(14-2)8(5-7)9(12)6-11/h3-5,9,12H,6,11H2,1-2H3 |
| InChIKey | VFRCNXKYZVQYLX-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 64.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | 165 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze Desglymidodrine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Desglymidodrine?
The IUPAC name of Desglymidodrine (CID 43260) is 2-amino-1-(2,5-dimethoxyphenyl)ethanol.
What is the SMILES notation for Desglymidodrine?
The canonical SMILES for Desglymidodrine is COC1=CC(=C(C=C1)OC)C(CN)O.
What is the InChIKey of Desglymidodrine?
The InChIKey is VFRCNXKYZVQYLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO3/c1-13-7-3-4-10(14-2)8(5-7)9(12)6-11/h3-5,9,12H,6,11H2,1-2H3.
What are the key properties of Desglymidodrine?
Desglymidodrine has a molecular weight of 197.23 g/mol, XLogP of 0.10, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Desglymidodrine is sourced from PubChem (CID 43260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).