About (+-)-2,5-Dimethoxyamphetamine
(+-)-2,5-Dimethoxyamphetamine (PubChem CID 62787) has the molecular formula C11H17NO2
and a molecular weight of 195.26 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)propan-2-amine.
Molecular Properties
| Compound Name | (+-)-2,5-Dimethoxyamphetamine |
| PubChem CID | 62787 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)propan-2-amine |
| SMILES | CC(CC1=C(C=CC(=C1)OC)OC)N |
| InChI | InChI=1S/C11H17NO2/c1-8(12)6-9-7-10(13-2)4-5-11(9)14-3/h4-5,7-8H,6,12H2,1-3H3 |
| InChIKey | LATVFYDIBMDBSY-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 44.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | 163 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (+-)-2,5-Dimethoxyamphetamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (+-)-2,5-Dimethoxyamphetamine?
The IUPAC name of (+-)-2,5-Dimethoxyamphetamine (CID 62787) is 1-(2,5-dimethoxyphenyl)propan-2-amine.
What is the SMILES notation for (+-)-2,5-Dimethoxyamphetamine?
The canonical SMILES for (+-)-2,5-Dimethoxyamphetamine is CC(CC1=C(C=CC(=C1)OC)OC)N.
What is the InChIKey of (+-)-2,5-Dimethoxyamphetamine?
The InChIKey is LATVFYDIBMDBSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO2/c1-8(12)6-9-7-10(13-2)4-5-11(9)14-3/h4-5,7-8H,6,12H2,1-3H3.
What are the key properties of (+-)-2,5-Dimethoxyamphetamine?
(+-)-2,5-Dimethoxyamphetamine has a molecular weight of 195.26 g/mol, XLogP of 1.70, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (+-)-2,5-Dimethoxyamphetamine is sourced from PubChem (CID 62787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).