About 3-Methoxyphenethylamine
3-Methoxyphenethylamine (PubChem CID 74866) has the molecular formula C9H13NO
and a molecular weight of 151.21 g/mol. Its IUPAC name is 2-(3-methoxyphenyl)ethanamine.
Molecular Properties
| Compound Name | 3-Methoxyphenethylamine |
| PubChem CID | 74866 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | 2-(3-methoxyphenyl)ethanamine |
| SMILES | COC1=CC=CC(=C1)CCN |
| InChI | InChI=1S/C9H13NO/c1-11-9-4-2-3-8(7-9)5-6-10/h2-4,7H,5-6,10H2,1H3 |
| InChIKey | WJBMRZAHTUFBGE-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 35.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | 106 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-Methoxyphenethylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-Methoxyphenethylamine?
The IUPAC name of 3-Methoxyphenethylamine (CID 74866) is 2-(3-methoxyphenyl)ethanamine.
What is the SMILES notation for 3-Methoxyphenethylamine?
The canonical SMILES for 3-Methoxyphenethylamine is COC1=CC=CC(=C1)CCN.
What is the InChIKey of 3-Methoxyphenethylamine?
The InChIKey is WJBMRZAHTUFBGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO/c1-11-9-4-2-3-8(7-9)5-6-10/h2-4,7H,5-6,10H2,1H3.
What are the key properties of 3-Methoxyphenethylamine?
3-Methoxyphenethylamine has a molecular weight of 151.21 g/mol, XLogP of 1.60, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-Methoxyphenethylamine is sourced from PubChem (CID 74866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).