C10H14N4O3 — CID 43289097
N-(2-cyanoethyl)-3-(2,5-dioxoimidazolidin-1-yl)-N-methylpropanamide (PubChem CID 43289097) has the molecular formula C10H14N4O3 and a molecular weight of 238.25 g/mol. Its IUPAC name is N-(2-cyanoethyl)-3-(2,5-dioxoimidazolidin-1-yl)-N-methylpropanamide.
| Compound Name | N-(2-cyanoethyl)-3-(2,5-dioxoimidazolidin-1-yl)-N-methylpropanamide |
|---|---|
| PubChem CID | 43289097 |
| Molecular Formula | C10H14N4O3 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | N-(2-cyanoethyl)-3-(2,5-dioxoimidazolidin-1-yl)-N-methylpropanamide |
| SMILES | CN(CCC#N)C(=O)CCN1C(=O)CNC1=O |
| InChI | InChI=1S/C10H14N4O3/c1-13(5-2-4-11)8(15)3-6-14-9(16)7-12-10(14)17/h2-3,5-7H2,1H3,(H,12,17) |
| InChIKey | ZAHIQOHHQVKGRY-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 93.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|